C20H31N3 — CID 129238626
(E,5E)-5-ethylidene-3,7-dimethyl-8-[(2E)-2-[(E)-pent-2-enylidene]-1H-imidazol-3-yl]oct-6-en-4-imine (PubChem CID 129238626) has the molecular formula C20H31N3 and a molecular weight of 313.49 g/mol. Its IUPAC name is (E,5E)-5-ethylidene-3,7-dimethyl-8-[(2E)-2-[(E)-pent-2-enylidene]-1H-imidazol-3-yl]oct-6-en-4-imine.
| Compound Name | (E,5E)-5-ethylidene-3,7-dimethyl-8-[(2E)-2-[(E)-pent-2-enylidene]-1H-imidazol-3-yl]oct-6-en-4-imine |
|---|---|
| PubChem CID | 129238626 |
| Molecular Formula | C20H31N3 |
| Molecular Weight | 313.49 g/mol |
| Exact Mass | 313.25 |
| IUPAC Name | (E,5E)-5-ethylidene-3,7-dimethyl-8-[(2E)-2-[(E)-pent-2-enylidene]-1H-imidazol-3-yl]oct-6-en-4-imine |
| SMILES | [H]/N=C(C(/C=C(\C)CN1C=CN/C1=C\C=C\CC)=C/C)\C(C)CC |
| InChI | InChI=1S/C20H31N3/c1-6-9-10-11-19-22-12-13-23(19)15-16(4)14-18(8-3)20(21)17(5)7-2/h8-14,17,21-22H,6-7,15H2,1-5H3/b10-9+,16-14+,18-8+,19-11+,21-20+ |
| InChIKey | XUAFDYPFNRXDJR-ZQQVIDGISA-N |
| XLogP | 5.13 |
| TPSA | 39.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.49 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|