C22H30N4 — CID 129238758
N'-cyclopropyl-2-[[(2E,3Z)-3-ethylidene-2-[(Z)-hex-2-enylidene]pyrrol-1-yl]methyl]-3,4-dihydropyridine-6-carboximidamide (PubChem CID 129238758) has the molecular formula C22H30N4 and a molecular weight of 350.51 g/mol. Its IUPAC name is N'-cyclopropyl-2-[[(2E,3Z)-3-ethylidene-2-[(Z)-hex-2-enylidene]pyrrol-1-yl]methyl]-3,4-dihydropyridine-6-carboximidamide.
| Compound Name | N'-cyclopropyl-2-[[(2E,3Z)-3-ethylidene-2-[(Z)-hex-2-enylidene]pyrrol-1-yl]methyl]-3,4-dihydropyridine-6-carboximidamide |
|---|---|
| PubChem CID | 129238758 |
| Molecular Formula | C22H30N4 |
| Molecular Weight | 350.51 g/mol |
| Exact Mass | 350.25 |
| IUPAC Name | N'-cyclopropyl-2-[[(2E,3Z)-3-ethylidene-2-[(Z)-hex-2-enylidene]pyrrol-1-yl]methyl]-3,4-dihydropyridine-6-carboximidamide |
| SMILES | C/C=c1/ccn(CC2=NC(/C(N)=N/C3CC3)=CCC2)/c1=C/C=C\CCC |
| InChI | InChI=1S/C22H30N4/c1-3-5-6-7-11-21-17(4-2)14-15-26(21)16-19-9-8-10-20(24-19)22(23)25-18-12-13-18/h4,6-7,10-11,14-15,18H,3,5,8-9,12-13,16H2,1-2H3,(H2,23,25)/b7-6-,17-4-,21-11+ |
| InChIKey | PWOHHVALLIPUGK-NQXLPPITSA-N |
| XLogP | 3.06 |
| TPSA | 55.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.51 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|