C14H23N — CID 129238767
3-[(3Z)-4,6-dimethylhepta-1,3-dien-3-yl]-1-methyl-2,5-dihydropyrrole (PubChem CID 129238767) has the molecular formula C14H23N and a molecular weight of 205.34 g/mol. Its IUPAC name is 3-[(3Z)-4,6-dimethylhepta-1,3-dien-3-yl]-1-methyl-2,5-dihydropyrrole.
| Compound Name | 3-[(3Z)-4,6-dimethylhepta-1,3-dien-3-yl]-1-methyl-2,5-dihydropyrrole |
|---|---|
| PubChem CID | 129238767 |
| Molecular Formula | C14H23N |
| Molecular Weight | 205.34 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | 3-[(3Z)-4,6-dimethylhepta-1,3-dien-3-yl]-1-methyl-2,5-dihydropyrrole |
| SMILES | C=C/C(C1=CCN(C)C1)=C(\C)CC(C)C |
| InChI | InChI=1S/C14H23N/c1-6-14(12(4)9-11(2)3)13-7-8-15(5)10-13/h6-7,11H,1,8-10H2,2-5H3/b14-12- |
| InChIKey | YPHQEOWCSANBCG-OWBHPGMISA-N |
| XLogP | 3.41 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.34 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|