About 2-[(Z)-hept-2-enylidene]-1,3-dimethylimidazole
2-[(Z)-hept-2-enylidene]-1,3-dimethylimidazole (PubChem CID 129238804) has the molecular formula C12H20N2
and a molecular weight of 192.31 g/mol. Its IUPAC name is 2-[(Z)-hept-2-enylidene]-1,3-dimethylimidazole.
Molecular Properties
| Compound Name | 2-[(Z)-hept-2-enylidene]-1,3-dimethylimidazole |
| PubChem CID | 129238804 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | 2-[(Z)-hept-2-enylidene]-1,3-dimethylimidazole |
| SMILES | CCCC/C=C\C=C1N(C)C=CN1C |
| InChI | InChI=1S/C12H20N2/c1-4-5-6-7-8-9-12-13(2)10-11-14(12)3/h7-11H,4-6H2,1-3H3/b8-7- |
| InChIKey | IZYVOSFTSFXTQZ-FPLPWBNLSA-N |
| XLogP | 2.92 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[(Z)-hept-2-enylidene]-1,3-dimethylimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(Z)-hept-2-enylidene]-1,3-dimethylimidazole?
The IUPAC name of 2-[(Z)-hept-2-enylidene]-1,3-dimethylimidazole (CID 129238804) is 2-[(Z)-hept-2-enylidene]-1,3-dimethylimidazole.
What is the SMILES notation for 2-[(Z)-hept-2-enylidene]-1,3-dimethylimidazole?
The canonical SMILES for 2-[(Z)-hept-2-enylidene]-1,3-dimethylimidazole is CCCC/C=C\C=C1N(C)C=CN1C.
What is the InChIKey of 2-[(Z)-hept-2-enylidene]-1,3-dimethylimidazole?
The InChIKey is IZYVOSFTSFXTQZ-FPLPWBNLSA-N. The full InChI is InChI=1S/C12H20N2/c1-4-5-6-7-8-9-12-13(2)10-11-14(12)3/h7-11H,4-6H2,1-3H3/b8-7-.
What are the key properties of 2-[(Z)-hept-2-enylidene]-1,3-dimethylimidazole?
2-[(Z)-hept-2-enylidene]-1,3-dimethylimidazole has a molecular weight of 192.31 g/mol, XLogP of 2.92, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(Z)-hept-2-enylidene]-1,3-dimethylimidazole is sourced from PubChem (CID 129238804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).