About 2-(2-fluoro-4,6-dimethoxypyrimidin-5-yl)sulfanylpyrimidine-4,6-diamine
2-(2-fluoro-4,6-dimethoxypyrimidin-5-yl)sulfanylpyrimidine-4,6-diamine (PubChem CID 129238830) has the molecular formula C10H11FN6O2S
and a molecular weight of 298.30 g/mol. Its IUPAC name is 2-(2-fluoro-4,6-dimethoxypyrimidin-5-yl)sulfanylpyrimidine-4,6-diamine.
Molecular Properties
| Compound Name | 2-(2-fluoro-4,6-dimethoxypyrimidin-5-yl)sulfanylpyrimidine-4,6-diamine |
| PubChem CID | 129238830 |
| Molecular Formula | C10H11FN6O2S |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 2-(2-fluoro-4,6-dimethoxypyrimidin-5-yl)sulfanylpyrimidine-4,6-diamine |
| SMILES | COc1nc(F)nc(OC)c1Sc1nc(N)cc(N)n1 |
| InChI | InChI=1S/C10H11FN6O2S/c1-18-7-6(8(19-2)17-9(11)16-7)20-10-14-4(12)3-5(13)15-10/h3H,1-2H3,(H4,12,13,14,15) |
| InChIKey | UPGDICVWMITPBP-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 122.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze 2-(2-fluoro-4,6-dimethoxypyrimidin-5-yl)sulfanylpyrimidine-4,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-fluoro-4,6-dimethoxypyrimidin-5-yl)sulfanylpyrimidine-4,6-diamine?
The IUPAC name of 2-(2-fluoro-4,6-dimethoxypyrimidin-5-yl)sulfanylpyrimidine-4,6-diamine (CID 129238830) is 2-(2-fluoro-4,6-dimethoxypyrimidin-5-yl)sulfanylpyrimidine-4,6-diamine.
What is the SMILES notation for 2-(2-fluoro-4,6-dimethoxypyrimidin-5-yl)sulfanylpyrimidine-4,6-diamine?
The canonical SMILES for 2-(2-fluoro-4,6-dimethoxypyrimidin-5-yl)sulfanylpyrimidine-4,6-diamine is COc1nc(F)nc(OC)c1Sc1nc(N)cc(N)n1.
What is the InChIKey of 2-(2-fluoro-4,6-dimethoxypyrimidin-5-yl)sulfanylpyrimidine-4,6-diamine?
The InChIKey is UPGDICVWMITPBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11FN6O2S/c1-18-7-6(8(19-2)17-9(11)16-7)20-10-14-4(12)3-5(13)15-10/h3H,1-2H3,(H4,12,13,14,15).
What are the key properties of 2-(2-fluoro-4,6-dimethoxypyrimidin-5-yl)sulfanylpyrimidine-4,6-diamine?
2-(2-fluoro-4,6-dimethoxypyrimidin-5-yl)sulfanylpyrimidine-4,6-diamine has a molecular weight of 298.30 g/mol, XLogP of 0.74, 4 rotatable bonds, 2 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-fluoro-4,6-dimethoxypyrimidin-5-yl)sulfanylpyrimidine-4,6-diamine is sourced from PubChem (CID 129238830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).