C10H17NO — CID 129238834
(2R,3R,4E)-4-ethenyl-2-(methylamino)hepta-4,6-dien-3-ol (PubChem CID 129238834) has the molecular formula C10H17NO and a molecular weight of 167.25 g/mol. Its IUPAC name is (2R,3R,4E)-4-ethenyl-2-(methylamino)hepta-4,6-dien-3-ol.
| Compound Name | (2R,3R,4E)-4-ethenyl-2-(methylamino)hepta-4,6-dien-3-ol |
|---|---|
| PubChem CID | 129238834 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | (2R,3R,4E)-4-ethenyl-2-(methylamino)hepta-4,6-dien-3-ol |
| SMILES | C=C/C=C(\C=C)[C@@H](O)[C@@H](C)NC |
| InChI | InChI=1S/C10H17NO/c1-5-7-9(6-2)10(12)8(3)11-4/h5-8,10-12H,1-2H2,3-4H3/b9-7+/t8-,10+/m1/s1 |
| InChIKey | ISDVIYVNGLLFLX-RXFWIBKSSA-N |
| XLogP | 1.25 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|