About 4,6-diphenyl-1,3,5-triazinan-2-amine
4,6-diphenyl-1,3,5-triazinan-2-amine (PubChem CID 129238906) has the molecular formula C15H18N4
and a molecular weight of 254.34 g/mol. Its IUPAC name is 4,6-diphenyl-1,3,5-triazinan-2-amine.
Molecular Properties
| Compound Name | 4,6-diphenyl-1,3,5-triazinan-2-amine |
| PubChem CID | 129238906 |
| Molecular Formula | C15H18N4 |
| Molecular Weight | 254.34 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | 4,6-diphenyl-1,3,5-triazinan-2-amine |
| SMILES | NC1NC(c2ccccc2)NC(c2ccccc2)N1 |
| InChI | InChI=1S/C15H18N4/c16-15-18-13(11-7-3-1-4-8-11)17-14(19-15)12-9-5-2-6-10-12/h1-10,13-15,17-19H,16H2 |
| InChIKey | NYDYIFQRZAWSOE-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 62.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.34 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4,6-diphenyl-1,3,5-triazinan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-diphenyl-1,3,5-triazinan-2-amine?
The IUPAC name of 4,6-diphenyl-1,3,5-triazinan-2-amine (CID 129238906) is 4,6-diphenyl-1,3,5-triazinan-2-amine.
What is the SMILES notation for 4,6-diphenyl-1,3,5-triazinan-2-amine?
The canonical SMILES for 4,6-diphenyl-1,3,5-triazinan-2-amine is NC1NC(c2ccccc2)NC(c2ccccc2)N1.
What is the InChIKey of 4,6-diphenyl-1,3,5-triazinan-2-amine?
The InChIKey is NYDYIFQRZAWSOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N4/c16-15-18-13(11-7-3-1-4-8-11)17-14(19-15)12-9-5-2-6-10-12/h1-10,13-15,17-19H,16H2.
What are the key properties of 4,6-diphenyl-1,3,5-triazinan-2-amine?
4,6-diphenyl-1,3,5-triazinan-2-amine has a molecular weight of 254.34 g/mol, XLogP of 1.41, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-diphenyl-1,3,5-triazinan-2-amine is sourced from PubChem (CID 129238906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).