About 2-ethyl-N-methyl-1,2-dihydropyridin-6-amine
2-ethyl-N-methyl-1,2-dihydropyridin-6-amine (PubChem CID 129238981) has the molecular formula C8H14N2
and a molecular weight of 138.21 g/mol. Its IUPAC name is 2-ethyl-N-methyl-1,2-dihydropyridin-6-amine.
Molecular Properties
| Compound Name | 2-ethyl-N-methyl-1,2-dihydropyridin-6-amine |
| PubChem CID | 129238981 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | 2-ethyl-N-methyl-1,2-dihydropyridin-6-amine |
| SMILES | CCC1C=CC=C(NC)N1 |
| InChI | InChI=1S/C8H14N2/c1-3-7-5-4-6-8(9-2)10-7/h4-7,9-10H,3H2,1-2H3 |
| InChIKey | XWMKBTRRZWEMAY-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-ethyl-N-methyl-1,2-dihydropyridin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-N-methyl-1,2-dihydropyridin-6-amine?
The IUPAC name of 2-ethyl-N-methyl-1,2-dihydropyridin-6-amine (CID 129238981) is 2-ethyl-N-methyl-1,2-dihydropyridin-6-amine.
What is the SMILES notation for 2-ethyl-N-methyl-1,2-dihydropyridin-6-amine?
The canonical SMILES for 2-ethyl-N-methyl-1,2-dihydropyridin-6-amine is CCC1C=CC=C(NC)N1.
What is the InChIKey of 2-ethyl-N-methyl-1,2-dihydropyridin-6-amine?
The InChIKey is XWMKBTRRZWEMAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2/c1-3-7-5-4-6-8(9-2)10-7/h4-7,9-10H,3H2,1-2H3.
What are the key properties of 2-ethyl-N-methyl-1,2-dihydropyridin-6-amine?
2-ethyl-N-methyl-1,2-dihydropyridin-6-amine has a molecular weight of 138.21 g/mol, XLogP of 0.99, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-N-methyl-1,2-dihydropyridin-6-amine is sourced from PubChem (CID 129238981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).