About tert-butyl (2S)-2-(N-ethyl-N,N'-dimethylcarbamimidoyl)pyrrolidine-1-carboxylate
tert-butyl (2S)-2-(N-ethyl-N,N'-dimethylcarbamimidoyl)pyrrolidine-1-carboxylate (PubChem CID 129239341) has the molecular formula C14H27N3O2
and a molecular weight of 269.39 g/mol. Its IUPAC name is tert-butyl (2S)-2-(N-ethyl-N,N'-dimethylcarbamimidoyl)pyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl (2S)-2-(N-ethyl-N,N'-dimethylcarbamimidoyl)pyrrolidine-1-carboxylate |
| PubChem CID | 129239341 |
| Molecular Formula | C14H27N3O2 |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.21 |
| IUPAC Name | tert-butyl (2S)-2-(N-ethyl-N,N'-dimethylcarbamimidoyl)pyrrolidine-1-carboxylate |
| SMILES | CCN(C)/C(=N\C)[C@@H]1CCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H27N3O2/c1-7-16(6)12(15-5)11-9-8-10-17(11)13(18)19-14(2,3)4/h11H,7-10H2,1-6H3/b15-12-/t11-/m0/s1 |
| InChIKey | YTQBHSNKWZIAJF-HTEPKEGRSA-N |
| XLogP | 2.37 |
| TPSA | 45.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl (2S)-2-(N-ethyl-N,N'-dimethylcarbamimidoyl)pyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (2S)-2-(N-ethyl-N,N'-dimethylcarbamimidoyl)pyrrolidine-1-carboxylate?
The IUPAC name of tert-butyl (2S)-2-(N-ethyl-N,N'-dimethylcarbamimidoyl)pyrrolidine-1-carboxylate (CID 129239341) is tert-butyl (2S)-2-(N-ethyl-N,N'-dimethylcarbamimidoyl)pyrrolidine-1-carboxylate.
What is the SMILES notation for tert-butyl (2S)-2-(N-ethyl-N,N'-dimethylcarbamimidoyl)pyrrolidine-1-carboxylate?
The canonical SMILES for tert-butyl (2S)-2-(N-ethyl-N,N'-dimethylcarbamimidoyl)pyrrolidine-1-carboxylate is CCN(C)/C(=N\C)[C@@H]1CCCN1C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl (2S)-2-(N-ethyl-N,N'-dimethylcarbamimidoyl)pyrrolidine-1-carboxylate?
The InChIKey is YTQBHSNKWZIAJF-HTEPKEGRSA-N. The full InChI is InChI=1S/C14H27N3O2/c1-7-16(6)12(15-5)11-9-8-10-17(11)13(18)19-14(2,3)4/h11H,7-10H2,1-6H3/b15-12-/t11-/m0/s1.
What are the key properties of tert-butyl (2S)-2-(N-ethyl-N,N'-dimethylcarbamimidoyl)pyrrolidine-1-carboxylate?
tert-butyl (2S)-2-(N-ethyl-N,N'-dimethylcarbamimidoyl)pyrrolidine-1-carboxylate has a molecular weight of 269.39 g/mol, XLogP of 2.37, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (2S)-2-(N-ethyl-N,N'-dimethylcarbamimidoyl)pyrrolidine-1-carboxylate is sourced from PubChem (CID 129239341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).