C27H23Cl2FN4O — CID 129239469
(2-chloro-5-fluorophenyl)-[2-[[2-(4-chlorophenyl)imidazo[1,2-a]pyridin-3-yl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methanone (PubChem CID 129239469) has the molecular formula C27H23Cl2FN4O and a molecular weight of 509.41 g/mol. Its IUPAC name is (2-chloro-5-fluorophenyl)-[2-[[2-(4-chlorophenyl)imidazo[1,2-a]pyridin-3-yl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methanone.
| Compound Name | (2-chloro-5-fluorophenyl)-[2-[[2-(4-chlorophenyl)imidazo[1,2-a]pyridin-3-yl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methanone |
|---|---|
| PubChem CID | 129239469 |
| Molecular Formula | C27H23Cl2FN4O |
| Molecular Weight | 509.41 g/mol |
| Exact Mass | 508.12 |
| IUPAC Name | (2-chloro-5-fluorophenyl)-[2-[[2-(4-chlorophenyl)imidazo[1,2-a]pyridin-3-yl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methanone |
| SMILES | O=C(c1cc(F)ccc1Cl)N1CC2CN(Cc3c(-c4ccc(Cl)cc4)nc4ccccn34)CC2C1 |
| InChI | InChI=1S/C27H23Cl2FN4O/c28-20-6-4-17(5-7-20)26-24(34-10-2-1-3-25(34)31-26)16-32-12-18-14-33(15-19(18)13-32)27(35)22-11-21(30)8-9-23(22)29/h1-11,18-19H,12-16H2 |
| InChIKey | FVMNAHCSSKTRTH-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 40.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.41 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |