About (6-chloro-1,2-dihydropyridin-3-yl)methyl 3-nitroso-3-oxo-2-phenylpropanoate
(6-chloro-1,2-dihydropyridin-3-yl)methyl 3-nitroso-3-oxo-2-phenylpropanoate (PubChem CID 129239471) has the molecular formula C15H13ClN2O4
and a molecular weight of 320.73 g/mol. Its IUPAC name is (6-chloro-1,2-dihydropyridin-3-yl)methyl 3-nitroso-3-oxo-2-phenylpropanoate.
Molecular Properties
| Compound Name | (6-chloro-1,2-dihydropyridin-3-yl)methyl 3-nitroso-3-oxo-2-phenylpropanoate |
| PubChem CID | 129239471 |
| Molecular Formula | C15H13ClN2O4 |
| Molecular Weight | 320.73 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | (6-chloro-1,2-dihydropyridin-3-yl)methyl 3-nitroso-3-oxo-2-phenylpropanoate |
| SMILES | O=NC(=O)C(C(=O)OCC1=CC=C(Cl)NC1)c1ccccc1 |
| InChI | InChI=1S/C15H13ClN2O4/c16-12-7-6-10(8-17-12)9-22-15(20)13(14(19)18-21)11-4-2-1-3-5-11/h1-7,13,17H,8-9H2 |
| InChIKey | QYYFPPSADLFARG-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.73 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze (6-chloro-1,2-dihydropyridin-3-yl)methyl 3-nitroso-3-oxo-2-phenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-chloro-1,2-dihydropyridin-3-yl)methyl 3-nitroso-3-oxo-2-phenylpropanoate?
The IUPAC name of (6-chloro-1,2-dihydropyridin-3-yl)methyl 3-nitroso-3-oxo-2-phenylpropanoate (CID 129239471) is (6-chloro-1,2-dihydropyridin-3-yl)methyl 3-nitroso-3-oxo-2-phenylpropanoate.
What is the SMILES notation for (6-chloro-1,2-dihydropyridin-3-yl)methyl 3-nitroso-3-oxo-2-phenylpropanoate?
The canonical SMILES for (6-chloro-1,2-dihydropyridin-3-yl)methyl 3-nitroso-3-oxo-2-phenylpropanoate is O=NC(=O)C(C(=O)OCC1=CC=C(Cl)NC1)c1ccccc1.
What is the InChIKey of (6-chloro-1,2-dihydropyridin-3-yl)methyl 3-nitroso-3-oxo-2-phenylpropanoate?
The InChIKey is QYYFPPSADLFARG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13ClN2O4/c16-12-7-6-10(8-17-12)9-22-15(20)13(14(19)18-21)11-4-2-1-3-5-11/h1-7,13,17H,8-9H2.
What are the key properties of (6-chloro-1,2-dihydropyridin-3-yl)methyl 3-nitroso-3-oxo-2-phenylpropanoate?
(6-chloro-1,2-dihydropyridin-3-yl)methyl 3-nitroso-3-oxo-2-phenylpropanoate has a molecular weight of 320.73 g/mol, XLogP of 2.22, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (6-chloro-1,2-dihydropyridin-3-yl)methyl 3-nitroso-3-oxo-2-phenylpropanoate is sourced from PubChem (CID 129239471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).