C14H20F3N5O4 — CID 129239766
N-[6-[2-(dimethylamino)ethyl-methylamino]-5-nitro-2-(2,2,2-trifluoroethoxy)-3-pyridinyl]acetamide (PubChem CID 129239766) has the molecular formula C14H20F3N5O4 and a molecular weight of 379.34 g/mol. Its IUPAC name is N-[6-[2-(dimethylamino)ethyl-methylamino]-5-nitro-2-(2,2,2-trifluoroethoxy)-3-pyridinyl]acetamide.
| Compound Name | N-[6-[2-(dimethylamino)ethyl-methylamino]-5-nitro-2-(2,2,2-trifluoroethoxy)-3-pyridinyl]acetamide |
|---|---|
| PubChem CID | 129239766 |
| Molecular Formula | C14H20F3N5O4 |
| Molecular Weight | 379.34 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | N-[6-[2-(dimethylamino)ethyl-methylamino]-5-nitro-2-(2,2,2-trifluoroethoxy)-3-pyridinyl]acetamide |
| SMILES | CC(=O)Nc1cc([N+](=O)[O-])c(N(C)CCN(C)C)nc1OCC(F)(F)F |
| InChI | InChI=1S/C14H20F3N5O4/c1-9(23)18-10-7-11(22(24)25)12(21(4)6-5-20(2)3)19-13(10)26-8-14(15,16)17/h7H,5-6,8H2,1-4H3,(H,18,23) |
| InChIKey | PPQACIQMAISYTP-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 100.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.34 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|