C13H18F3N5O5 — CID 129239793
[6-[2-(dimethylamino)ethyl-methylamino]-5-nitro-2-(2,2,2-trifluoroethoxy)-3-pyridinyl]carbamic acid (PubChem CID 129239793) has the molecular formula C13H18F3N5O5 and a molecular weight of 381.31 g/mol. Its IUPAC name is [6-[2-(dimethylamino)ethyl-methylamino]-5-nitro-2-(2,2,2-trifluoroethoxy)-3-pyridinyl]carbamic acid.
| Compound Name | [6-[2-(dimethylamino)ethyl-methylamino]-5-nitro-2-(2,2,2-trifluoroethoxy)-3-pyridinyl]carbamic acid |
|---|---|
| PubChem CID | 129239793 |
| Molecular Formula | C13H18F3N5O5 |
| Molecular Weight | 381.31 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | [6-[2-(dimethylamino)ethyl-methylamino]-5-nitro-2-(2,2,2-trifluoroethoxy)-3-pyridinyl]carbamic acid |
| SMILES | CN(C)CCN(C)c1nc(OCC(F)(F)F)c(NC(=O)O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H18F3N5O5/c1-19(2)4-5-20(3)10-9(21(24)25)6-8(17-12(22)23)11(18-10)26-7-13(14,15)16/h6,17H,4-5,7H2,1-3H3,(H,22,23) |
| InChIKey | GNKKVPYNEJSBGT-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 121.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.31 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|