About (2,2-dipropyl-1,3-dioxan-5-yl)methyl methanesulfonate
(2,2-dipropyl-1,3-dioxan-5-yl)methyl methanesulfonate (PubChem CID 129239842) has the molecular formula C12H24O5S
and a molecular weight of 280.39 g/mol. Its IUPAC name is (2,2-dipropyl-1,3-dioxan-5-yl)methyl methanesulfonate.
Molecular Properties
| Compound Name | (2,2-dipropyl-1,3-dioxan-5-yl)methyl methanesulfonate |
| PubChem CID | 129239842 |
| Molecular Formula | C12H24O5S |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | (2,2-dipropyl-1,3-dioxan-5-yl)methyl methanesulfonate |
| SMILES | CCCC1(CCC)OCC(COS(C)(=O)=O)CO1 |
| InChI | InChI=1S/C12H24O5S/c1-4-6-12(7-5-2)15-8-11(9-16-12)10-17-18(3,13)14/h11H,4-10H2,1-3H3 |
| InChIKey | PKRVBHATMTZPCN-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (2,2-dipropyl-1,3-dioxan-5-yl)methyl methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,2-dipropyl-1,3-dioxan-5-yl)methyl methanesulfonate?
The IUPAC name of (2,2-dipropyl-1,3-dioxan-5-yl)methyl methanesulfonate (CID 129239842) is (2,2-dipropyl-1,3-dioxan-5-yl)methyl methanesulfonate.
What is the SMILES notation for (2,2-dipropyl-1,3-dioxan-5-yl)methyl methanesulfonate?
The canonical SMILES for (2,2-dipropyl-1,3-dioxan-5-yl)methyl methanesulfonate is CCCC1(CCC)OCC(COS(C)(=O)=O)CO1.
What is the InChIKey of (2,2-dipropyl-1,3-dioxan-5-yl)methyl methanesulfonate?
The InChIKey is PKRVBHATMTZPCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24O5S/c1-4-6-12(7-5-2)15-8-11(9-16-12)10-17-18(3,13)14/h11H,4-10H2,1-3H3.
What are the key properties of (2,2-dipropyl-1,3-dioxan-5-yl)methyl methanesulfonate?
(2,2-dipropyl-1,3-dioxan-5-yl)methyl methanesulfonate has a molecular weight of 280.39 g/mol, XLogP of 1.92, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2,2-dipropyl-1,3-dioxan-5-yl)methyl methanesulfonate is sourced from PubChem (CID 129239842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).