C25H27F3N8O3 — CID 129239917
2-N-[2-(dimethylamino)ethyl]-4-methyl-5-N-[4-(1-methylindol-3-yl)pyrimidin-2-yl]-3-nitro-6-(2,2,2-trifluoroethoxy)pyridine-2,5-diamine (PubChem CID 129239917) has the molecular formula C25H27F3N8O3 and a molecular weight of 544.54 g/mol. Its IUPAC name is 2-N-[2-(dimethylamino)ethyl]-4-methyl-5-N-[4-(1-methylindol-3-yl)pyrimidin-2-yl]-3-nitro-6-(2,2,2-trifluoroethoxy)pyridine-2,5-diamine.
| Compound Name | 2-N-[2-(dimethylamino)ethyl]-4-methyl-5-N-[4-(1-methylindol-3-yl)pyrimidin-2-yl]-3-nitro-6-(2,2,2-trifluoroethoxy)pyridine-2,5-diamine |
|---|---|
| PubChem CID | 129239917 |
| Molecular Formula | C25H27F3N8O3 |
| Molecular Weight | 544.54 g/mol |
| Exact Mass | 544.22 |
| IUPAC Name | 2-N-[2-(dimethylamino)ethyl]-4-methyl-5-N-[4-(1-methylindol-3-yl)pyrimidin-2-yl]-3-nitro-6-(2,2,2-trifluoroethoxy)pyridine-2,5-diamine |
| SMILES | Cc1c(Nc2nccc(-c3cn(C)c4ccccc34)n2)c(OCC(F)(F)F)nc(NCCN(C)C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C25H27F3N8O3/c1-15-20(23(39-14-25(26,27)28)33-22(21(15)36(37)38)29-11-12-34(2)3)32-24-30-10-9-18(31-24)17-13-35(4)19-8-6-5-7-16(17)19/h5-10,13H,11-12,14H2,1-4H3,(H,29,33)(H,30,31,32) |
| InChIKey | ZUGKSPXYCMHLCQ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.54 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|