C26H29N3O3 — CID 129240421
4-(cyclopropylmethoxy)-5-[(2-hydroxyethylamino)methyl]-N-(2-methyl-3-phenylphenyl)pyridine-2-carboxamide (PubChem CID 129240421) has the molecular formula C26H29N3O3 and a molecular weight of 431.54 g/mol. Its IUPAC name is 4-(cyclopropylmethoxy)-5-[(2-hydroxyethylamino)methyl]-N-(2-methyl-3-phenylphenyl)pyridine-2-carboxamide.
| Compound Name | 4-(cyclopropylmethoxy)-5-[(2-hydroxyethylamino)methyl]-N-(2-methyl-3-phenylphenyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 129240421 |
| Molecular Formula | C26H29N3O3 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | 4-(cyclopropylmethoxy)-5-[(2-hydroxyethylamino)methyl]-N-(2-methyl-3-phenylphenyl)pyridine-2-carboxamide |
| SMILES | Cc1c(NC(=O)c2cc(OCC3CC3)c(CNCCO)cn2)cccc1-c1ccccc1 |
| InChI | InChI=1S/C26H29N3O3/c1-18-22(20-6-3-2-4-7-20)8-5-9-23(18)29-26(31)24-14-25(32-17-19-10-11-19)21(16-28-24)15-27-12-13-30/h2-9,14,16,19,27,30H,10-13,15,17H2,1H3,(H,29,31) |
| InChIKey | GYSHEQAEIBZBTP-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|