About 2-[5,6-bis(3,5-dimethylphenyl)pyrazin-2-yl]-3-methylbenzonitrile
2-[5,6-bis(3,5-dimethylphenyl)pyrazin-2-yl]-3-methylbenzonitrile (PubChem CID 129241512) has the molecular formula C28H25N3
and a molecular weight of 403.53 g/mol. Its IUPAC name is 2-[5,6-bis(3,5-dimethylphenyl)pyrazin-2-yl]-3-methylbenzonitrile.
Molecular Properties
| Compound Name | 2-[5,6-bis(3,5-dimethylphenyl)pyrazin-2-yl]-3-methylbenzonitrile |
| PubChem CID | 129241512 |
| Molecular Formula | C28H25N3 |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | 2-[5,6-bis(3,5-dimethylphenyl)pyrazin-2-yl]-3-methylbenzonitrile |
| SMILES | Cc1cc(C)cc(-c2ncc(-c3c(C)cccc3C#N)nc2-c2cc(C)cc(C)c2)c1 |
| InChI | InChI=1S/C28H25N3/c1-17-9-18(2)12-23(11-17)27-28(24-13-19(3)10-20(4)14-24)31-25(16-30-27)26-21(5)7-6-8-22(26)15-29/h6-14,16H,1-5H3 |
| InChIKey | GQIALVQCFOJIFJ-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[5,6-bis(3,5-dimethylphenyl)pyrazin-2-yl]-3-methylbenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5,6-bis(3,5-dimethylphenyl)pyrazin-2-yl]-3-methylbenzonitrile?
The IUPAC name of 2-[5,6-bis(3,5-dimethylphenyl)pyrazin-2-yl]-3-methylbenzonitrile (CID 129241512) is 2-[5,6-bis(3,5-dimethylphenyl)pyrazin-2-yl]-3-methylbenzonitrile.
What is the SMILES notation for 2-[5,6-bis(3,5-dimethylphenyl)pyrazin-2-yl]-3-methylbenzonitrile?
The canonical SMILES for 2-[5,6-bis(3,5-dimethylphenyl)pyrazin-2-yl]-3-methylbenzonitrile is Cc1cc(C)cc(-c2ncc(-c3c(C)cccc3C#N)nc2-c2cc(C)cc(C)c2)c1.
What is the InChIKey of 2-[5,6-bis(3,5-dimethylphenyl)pyrazin-2-yl]-3-methylbenzonitrile?
The InChIKey is GQIALVQCFOJIFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H25N3/c1-17-9-18(2)12-23(11-17)27-28(24-13-19(3)10-20(4)14-24)31-25(16-30-27)26-21(5)7-6-8-22(26)15-29/h6-14,16H,1-5H3.
What are the key properties of 2-[5,6-bis(3,5-dimethylphenyl)pyrazin-2-yl]-3-methylbenzonitrile?
2-[5,6-bis(3,5-dimethylphenyl)pyrazin-2-yl]-3-methylbenzonitrile has a molecular weight of 403.53 g/mol, XLogP of 6.89, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5,6-bis(3,5-dimethylphenyl)pyrazin-2-yl]-3-methylbenzonitrile is sourced from PubChem (CID 129241512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).