About 1-ethylpyridin-2-imine
1-ethylpyridin-2-imine (PubChem CID 12924176) has the molecular formula C7H10N2
and a molecular weight of 122.17 g/mol. Its IUPAC name is 1-ethylpyridin-2-imine.
Molecular Properties
| Compound Name | 1-ethylpyridin-2-imine |
| PubChem CID | 12924176 |
| Molecular Formula | C7H10N2 |
| Molecular Weight | 122.17 g/mol |
| Exact Mass | 122.08 |
| IUPAC Name | 1-ethylpyridin-2-imine |
| SMILES | [H]/N=c1\ccccn1CC |
| InChI | InChI=1S/C7H10N2/c1-2-9-6-4-3-5-7(9)8/h3-6,8H,2H2,1H3/b8-7+ |
| InChIKey | NRLXPVZIUXKQNM-BQYQJAHWSA-N |
| XLogP | 0.99 |
| TPSA | 28.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.17 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-ethylpyridin-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethylpyridin-2-imine?
The IUPAC name of 1-ethylpyridin-2-imine (CID 12924176) is 1-ethylpyridin-2-imine.
What is the SMILES notation for 1-ethylpyridin-2-imine?
The canonical SMILES for 1-ethylpyridin-2-imine is [H]/N=c1\ccccn1CC.
What is the InChIKey of 1-ethylpyridin-2-imine?
The InChIKey is NRLXPVZIUXKQNM-BQYQJAHWSA-N. The full InChI is InChI=1S/C7H10N2/c1-2-9-6-4-3-5-7(9)8/h3-6,8H,2H2,1H3/b8-7+.
What are the key properties of 1-ethylpyridin-2-imine?
1-ethylpyridin-2-imine has a molecular weight of 122.17 g/mol, XLogP of 0.99, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethylpyridin-2-imine is sourced from PubChem (CID 12924176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).