C35H44ClN3O7S — CID 129241771
(2S,3S,4R,5S)-N-[4-[4-chloro-3-[[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]amino]methyl]phenyl]sulfanylbutyl]-2,3,4,5,6-pentahydroxy-N-methylhexanamide (PubChem CID 129241771) has the molecular formula C35H44ClN3O7S and a molecular weight of 686.27 g/mol. Its IUPAC name is (2S,3S,4R,5S)-N-[4-[4-chloro-3-[[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]amino]methyl]phenyl]sulfanylbutyl]-2,3,4,5,6-pentahydroxy-N-methylhexanamide.
| Compound Name | (2S,3S,4R,5S)-N-[4-[4-chloro-3-[[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]amino]methyl]phenyl]sulfanylbutyl]-2,3,4,5,6-pentahydroxy-N-methylhexanamide |
|---|---|
| PubChem CID | 129241771 |
| Molecular Formula | C35H44ClN3O7S |
| Molecular Weight | 686.27 g/mol |
| Exact Mass | 685.26 |
| IUPAC Name | (2S,3S,4R,5S)-N-[4-[4-chloro-3-[[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]amino]methyl]phenyl]sulfanylbutyl]-2,3,4,5,6-pentahydroxy-N-methylhexanamide |
| SMILES | CN(CCCCSc1ccc(Cl)c(CNC2(c3cnccc3-c3ccccc3OC3CC3)CC2)c1)C(=O)[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C35H44ClN3O7S/c1-39(34(45)33(44)32(43)31(42)29(41)21-40)16-4-5-17-47-24-10-11-28(36)22(18-24)19-38-35(13-14-35)27-20-37-15-12-25(27)26-6-2-3-7-30(26)46-23-8-9-23/h2-3,6-7,10-12,15,18,20,23,29,31-33,38,40-44H,4-5,8-9,13-14,16-17,19,21H2,1H3/t29-,31+,32-,33-/m0/s1 |
| InChIKey | LFTSPQPCOYZHLZ-YTQWTBANSA-N |
| XLogP | 3.49 |
| TPSA | 155.61 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.27 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|