About 1-hexylpyridin-2-imine
1-hexylpyridin-2-imine (PubChem CID 12924178) has the molecular formula C11H18N2
and a molecular weight of 178.28 g/mol. Its IUPAC name is 1-hexylpyridin-2-imine.
Molecular Properties
| Compound Name | 1-hexylpyridin-2-imine |
| PubChem CID | 12924178 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | 1-hexylpyridin-2-imine |
| SMILES | [H]/N=c1\ccccn1CCCCCC |
| InChI | InChI=1S/C11H18N2/c1-2-3-4-6-9-13-10-7-5-8-11(13)12/h5,7-8,10,12H,2-4,6,9H2,1H3/b12-11+ |
| InChIKey | UGZCUGYVZSCAGJ-VAWYXSNFSA-N |
| XLogP | 2.55 |
| TPSA | 28.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-hexylpyridin-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hexylpyridin-2-imine?
The IUPAC name of 1-hexylpyridin-2-imine (CID 12924178) is 1-hexylpyridin-2-imine.
What is the SMILES notation for 1-hexylpyridin-2-imine?
The canonical SMILES for 1-hexylpyridin-2-imine is [H]/N=c1\ccccn1CCCCCC.
What is the InChIKey of 1-hexylpyridin-2-imine?
The InChIKey is UGZCUGYVZSCAGJ-VAWYXSNFSA-N. The full InChI is InChI=1S/C11H18N2/c1-2-3-4-6-9-13-10-7-5-8-11(13)12/h5,7-8,10,12H,2-4,6,9H2,1H3/b12-11+.
What are the key properties of 1-hexylpyridin-2-imine?
1-hexylpyridin-2-imine has a molecular weight of 178.28 g/mol, XLogP of 2.55, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hexylpyridin-2-imine is sourced from PubChem (CID 12924178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).