C34H43Cl2N3O7 — CID 129241869
5-[2,5-dichloro-4-[[[1-[4-(2-methoxyphenyl)-3-pyridinyl]cyclopropyl]amino]methyl]phenyl]-N-methyl-N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]pentanamide (PubChem CID 129241869) has the molecular formula C34H43Cl2N3O7 and a molecular weight of 676.64 g/mol. Its IUPAC name is 5-[2,5-dichloro-4-[[[1-[4-(2-methoxyphenyl)-3-pyridinyl]cyclopropyl]amino]methyl]phenyl]-N-methyl-N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]pentanamide.
| Compound Name | 5-[2,5-dichloro-4-[[[1-[4-(2-methoxyphenyl)-3-pyridinyl]cyclopropyl]amino]methyl]phenyl]-N-methyl-N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]pentanamide |
|---|---|
| PubChem CID | 129241869 |
| Molecular Formula | C34H43Cl2N3O7 |
| Molecular Weight | 676.64 g/mol |
| Exact Mass | 675.25 |
| IUPAC Name | 5-[2,5-dichloro-4-[[[1-[4-(2-methoxyphenyl)-3-pyridinyl]cyclopropyl]amino]methyl]phenyl]-N-methyl-N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]pentanamide |
| SMILES | COc1ccccc1-c1ccncc1C1(NCc2cc(Cl)c(CCCCC(=O)N(C)C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)cc2Cl)CC1 |
| InChI | InChI=1S/C34H43Cl2N3O7/c1-39(19-28(41)32(44)33(45)29(42)20-40)31(43)10-6-3-7-21-15-27(36)22(16-26(21)35)17-38-34(12-13-34)25-18-37-14-11-23(25)24-8-4-5-9-30(24)46-2/h4-5,8-9,11,14-16,18,28-29,32-33,38,40-42,44-45H,3,6-7,10,12-13,17,19-20H2,1-2H3/t28-,29+,32+,33+/m0/s1 |
| InChIKey | NCIOMBXQMSHYGB-CKYDDUCJSA-N |
| XLogP | 3.45 |
| TPSA | 155.61 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.64 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|