C25H22F6N8O3S — CID 129242461
3-[2-[4-amino-2-[5-fluoro-1-(3,3,4,4,4-pentafluorobutyl)pyrazolo[5,4-b]pyridin-3-yl]-5-methyl-6-oxo-7H-pyrrolo[2,3-d]pyrimidin-5-yl]-1,3-thiazol-4-yl]-2,2-dimethylpropanoic acid (PubChem CID 129242461) has the molecular formula C25H22F6N8O3S and a molecular weight of 628.56 g/mol. Its IUPAC name is 3-[2-[4-amino-2-[5-fluoro-1-(3,3,4,4,4-pentafluorobutyl)pyrazolo[5,4-b]pyridin-3-yl]-5-methyl-6-oxo-7H-pyrrolo[2,3-d]pyrimidin-5-yl]-1,3-thiazol-4-yl]-2,2-dimethylpropanoic acid.
| Compound Name | 3-[2-[4-amino-2-[5-fluoro-1-(3,3,4,4,4-pentafluorobutyl)pyrazolo[5,4-b]pyridin-3-yl]-5-methyl-6-oxo-7H-pyrrolo[2,3-d]pyrimidin-5-yl]-1,3-thiazol-4-yl]-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 129242461 |
| Molecular Formula | C25H22F6N8O3S |
| Molecular Weight | 628.56 g/mol |
| Exact Mass | 628.14 |
| IUPAC Name | 3-[2-[4-amino-2-[5-fluoro-1-(3,3,4,4,4-pentafluorobutyl)pyrazolo[5,4-b]pyridin-3-yl]-5-methyl-6-oxo-7H-pyrrolo[2,3-d]pyrimidin-5-yl]-1,3-thiazol-4-yl]-2,2-dimethylpropanoic acid |
| SMILES | CC(C)(Cc1csc(C2(C)C(=O)Nc3nc(-c4nn(CCC(F)(F)C(F)(F)F)c5ncc(F)cc45)nc(N)c32)n1)C(=O)O |
| InChI | InChI=1S/C25H22F6N8O3S/c1-22(2,21(41)42)7-11-9-43-20(34-11)23(3)13-15(32)35-17(36-16(13)37-19(23)40)14-12-6-10(26)8-33-18(12)39(38-14)5-4-24(27,28)25(29,30)31/h6,8-9H,4-5,7H2,1-3H3,(H,41,42)(H3,32,35,36,37,40) |
| InChIKey | NPVCSWIUCWIDPL-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 161.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.56 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|