C28H19ClF5N7O3S — CID 129242514
3-[2-[4-amino-2-[6-chloro-1-(3,3,4,4,4-pentafluorobutyl)indazol-3-yl]-5-methyl-6-oxo-7H-pyrrolo[2,3-d]pyrimidin-5-yl]-1,3-thiazol-4-yl]benzoic acid (PubChem CID 129242514) has the molecular formula C28H19ClF5N7O3S and a molecular weight of 664.02 g/mol. Its IUPAC name is 3-[2-[4-amino-2-[6-chloro-1-(3,3,4,4,4-pentafluorobutyl)indazol-3-yl]-5-methyl-6-oxo-7H-pyrrolo[2,3-d]pyrimidin-5-yl]-1,3-thiazol-4-yl]benzoic acid.
| Compound Name | 3-[2-[4-amino-2-[6-chloro-1-(3,3,4,4,4-pentafluorobutyl)indazol-3-yl]-5-methyl-6-oxo-7H-pyrrolo[2,3-d]pyrimidin-5-yl]-1,3-thiazol-4-yl]benzoic acid |
|---|---|
| PubChem CID | 129242514 |
| Molecular Formula | C28H19ClF5N7O3S |
| Molecular Weight | 664.02 g/mol |
| Exact Mass | 663.09 |
| IUPAC Name | 3-[2-[4-amino-2-[6-chloro-1-(3,3,4,4,4-pentafluorobutyl)indazol-3-yl]-5-methyl-6-oxo-7H-pyrrolo[2,3-d]pyrimidin-5-yl]-1,3-thiazol-4-yl]benzoic acid |
| SMILES | CC1(c2nc(-c3cccc(C(=O)O)c3)cs2)C(=O)Nc2nc(-c3nn(CCC(F)(F)C(F)(F)F)c4cc(Cl)ccc34)nc(N)c21 |
| InChI | InChI=1S/C28H19ClF5N7O3S/c1-26(25-36-16(11-45-25)12-3-2-4-13(9-12)23(42)43)18-20(35)37-22(38-21(18)39-24(26)44)19-15-6-5-14(29)10-17(15)41(40-19)8-7-27(30,31)28(32,33)34/h2-6,9-11H,7-8H2,1H3,(H,42,43)(H3,35,37,38,39,44) |
| InChIKey | BNQJOQVUZZKJSX-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 148.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.02 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|