C22H17ClF5N9O3 — CID 129242573
2-[4-[4-amino-2-[6-chloro-1-(3,3,4,4,4-pentafluorobutyl)indazol-3-yl]-5-methyl-6-oxo-7H-pyrrolo[2,3-d]pyrimidin-5-yl]triazol-1-yl]acetic acid (PubChem CID 129242573) has the molecular formula C22H17ClF5N9O3 and a molecular weight of 585.88 g/mol. Its IUPAC name is 2-[4-[4-amino-2-[6-chloro-1-(3,3,4,4,4-pentafluorobutyl)indazol-3-yl]-5-methyl-6-oxo-7H-pyrrolo[2,3-d]pyrimidin-5-yl]triazol-1-yl]acetic acid.
| Compound Name | 2-[4-[4-amino-2-[6-chloro-1-(3,3,4,4,4-pentafluorobutyl)indazol-3-yl]-5-methyl-6-oxo-7H-pyrrolo[2,3-d]pyrimidin-5-yl]triazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 129242573 |
| Molecular Formula | C22H17ClF5N9O3 |
| Molecular Weight | 585.88 g/mol |
| Exact Mass | 585.11 |
| IUPAC Name | 2-[4-[4-amino-2-[6-chloro-1-(3,3,4,4,4-pentafluorobutyl)indazol-3-yl]-5-methyl-6-oxo-7H-pyrrolo[2,3-d]pyrimidin-5-yl]triazol-1-yl]acetic acid |
| SMILES | CC1(c2cn(CC(=O)O)nn2)C(=O)Nc2nc(-c3nn(CCC(F)(F)C(F)(F)F)c4cc(Cl)ccc34)nc(N)c21 |
| InChI | InChI=1S/C22H17ClF5N9O3/c1-20(12-7-36(35-33-12)8-13(38)39)14-16(29)30-18(31-17(14)32-19(20)40)15-10-3-2-9(23)6-11(10)37(34-15)5-4-21(24,25)22(26,27)28/h2-3,6-7H,4-5,8H2,1H3,(H,38,39)(H3,29,30,31,32,40) |
| InChIKey | NFYSQYNUNGNRGV-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 166.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.88 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|