C28H24ClF5N6O3 — CID 129242607
3-[4-[4-amino-2-[6-chloro-1-(3,3,4,4,4-pentafluorobutyl)indazol-3-yl]-5-methyl-6-oxo-7H-pyrrolo[2,3-d]pyrimidin-5-yl]phenyl]-2-methylpropanoic acid (PubChem CID 129242607) has the molecular formula C28H24ClF5N6O3 and a molecular weight of 622.98 g/mol. Its IUPAC name is 3-[4-[4-amino-2-[6-chloro-1-(3,3,4,4,4-pentafluorobutyl)indazol-3-yl]-5-methyl-6-oxo-7H-pyrrolo[2,3-d]pyrimidin-5-yl]phenyl]-2-methylpropanoic acid.
| Compound Name | 3-[4-[4-amino-2-[6-chloro-1-(3,3,4,4,4-pentafluorobutyl)indazol-3-yl]-5-methyl-6-oxo-7H-pyrrolo[2,3-d]pyrimidin-5-yl]phenyl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 129242607 |
| Molecular Formula | C28H24ClF5N6O3 |
| Molecular Weight | 622.98 g/mol |
| Exact Mass | 622.15 |
| IUPAC Name | 3-[4-[4-amino-2-[6-chloro-1-(3,3,4,4,4-pentafluorobutyl)indazol-3-yl]-5-methyl-6-oxo-7H-pyrrolo[2,3-d]pyrimidin-5-yl]phenyl]-2-methylpropanoic acid |
| SMILES | CC(Cc1ccc(C2(C)C(=O)Nc3nc(-c4nn(CCC(F)(F)C(F)(F)F)c5cc(Cl)ccc45)nc(N)c32)cc1)C(=O)O |
| InChI | InChI=1S/C28H24ClF5N6O3/c1-13(24(41)42)11-14-3-5-15(6-4-14)26(2)19-21(35)36-23(37-22(19)38-25(26)43)20-17-8-7-16(29)12-18(17)40(39-20)10-9-27(30,31)28(32,33)34/h3-8,12-13H,9-11H2,1-2H3,(H,41,42)(H3,35,36,37,38,43) |
| InChIKey | YXOMXGVZXSZYDT-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 136.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.98 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|