C25H20F5N7O3 — CID 129242631
2-[4-[4-amino-5-methyl-6-oxo-2-[1-(3,3,4,4,4-pentafluorobutyl)pyrazolo[5,4-b]pyridin-3-yl]-7H-pyrrolo[2,3-d]pyrimidin-5-yl]phenyl]acetic acid (PubChem CID 129242631) has the molecular formula C25H20F5N7O3 and a molecular weight of 561.47 g/mol. Its IUPAC name is 2-[4-[4-amino-5-methyl-6-oxo-2-[1-(3,3,4,4,4-pentafluorobutyl)pyrazolo[5,4-b]pyridin-3-yl]-7H-pyrrolo[2,3-d]pyrimidin-5-yl]phenyl]acetic acid.
| Compound Name | 2-[4-[4-amino-5-methyl-6-oxo-2-[1-(3,3,4,4,4-pentafluorobutyl)pyrazolo[5,4-b]pyridin-3-yl]-7H-pyrrolo[2,3-d]pyrimidin-5-yl]phenyl]acetic acid |
|---|---|
| PubChem CID | 129242631 |
| Molecular Formula | C25H20F5N7O3 |
| Molecular Weight | 561.47 g/mol |
| Exact Mass | 561.15 |
| IUPAC Name | 2-[4-[4-amino-5-methyl-6-oxo-2-[1-(3,3,4,4,4-pentafluorobutyl)pyrazolo[5,4-b]pyridin-3-yl]-7H-pyrrolo[2,3-d]pyrimidin-5-yl]phenyl]acetic acid |
| SMILES | CC1(c2ccc(CC(=O)O)cc2)C(=O)Nc2nc(-c3nn(CCC(F)(F)C(F)(F)F)c4ncccc34)nc(N)c21 |
| InChI | InChI=1S/C25H20F5N7O3/c1-23(13-6-4-12(5-7-13)11-15(38)39)16-18(31)33-20(34-19(16)35-22(23)40)17-14-3-2-9-32-21(14)37(36-17)10-8-24(26,27)25(28,29)30/h2-7,9H,8,10-11H2,1H3,(H,38,39)(H3,31,33,34,35,40) |
| InChIKey | ZTNBBADWKPUEDY-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 148.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.47 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|