C25H18ClF5N6O3 — CID 129242638
3-[4-amino-2-[6-chloro-1-(3,3,4,4,4-pentafluorobutyl)indazol-3-yl]-5-methyl-6-oxo-7H-pyrrolo[2,3-d]pyrimidin-5-yl]benzoic acid (PubChem CID 129242638) has the molecular formula C25H18ClF5N6O3 and a molecular weight of 580.90 g/mol. Its IUPAC name is 3-[4-amino-2-[6-chloro-1-(3,3,4,4,4-pentafluorobutyl)indazol-3-yl]-5-methyl-6-oxo-7H-pyrrolo[2,3-d]pyrimidin-5-yl]benzoic acid.
| Compound Name | 3-[4-amino-2-[6-chloro-1-(3,3,4,4,4-pentafluorobutyl)indazol-3-yl]-5-methyl-6-oxo-7H-pyrrolo[2,3-d]pyrimidin-5-yl]benzoic acid |
|---|---|
| PubChem CID | 129242638 |
| Molecular Formula | C25H18ClF5N6O3 |
| Molecular Weight | 580.90 g/mol |
| Exact Mass | 580.10 |
| IUPAC Name | 3-[4-amino-2-[6-chloro-1-(3,3,4,4,4-pentafluorobutyl)indazol-3-yl]-5-methyl-6-oxo-7H-pyrrolo[2,3-d]pyrimidin-5-yl]benzoic acid |
| SMILES | CC1(c2cccc(C(=O)O)c2)C(=O)Nc2nc(-c3nn(CCC(F)(F)C(F)(F)F)c4cc(Cl)ccc34)nc(N)c21 |
| InChI | InChI=1S/C25H18ClF5N6O3/c1-23(12-4-2-3-11(9-12)21(38)39)16-18(32)33-20(34-19(16)35-22(23)40)17-14-6-5-13(26)10-15(14)37(36-17)8-7-24(27,28)25(29,30)31/h2-6,9-10H,7-8H2,1H3,(H,38,39)(H3,32,33,34,35,40) |
| InChIKey | QXIZOTWBVXQCNF-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 136.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.90 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|