C29H26ClF5N6O3 — CID 129242640
3-[3-[4-amino-2-[6-chloro-1-(3,3,4,4,4-pentafluorobutyl)indazol-3-yl]-5-methyl-6-oxo-7H-pyrrolo[2,3-d]pyrimidin-5-yl]phenyl]-2,2-dimethylpropanoic acid (PubChem CID 129242640) has the molecular formula C29H26ClF5N6O3 and a molecular weight of 637.01 g/mol. Its IUPAC name is 3-[3-[4-amino-2-[6-chloro-1-(3,3,4,4,4-pentafluorobutyl)indazol-3-yl]-5-methyl-6-oxo-7H-pyrrolo[2,3-d]pyrimidin-5-yl]phenyl]-2,2-dimethylpropanoic acid.
| Compound Name | 3-[3-[4-amino-2-[6-chloro-1-(3,3,4,4,4-pentafluorobutyl)indazol-3-yl]-5-methyl-6-oxo-7H-pyrrolo[2,3-d]pyrimidin-5-yl]phenyl]-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 129242640 |
| Molecular Formula | C29H26ClF5N6O3 |
| Molecular Weight | 637.01 g/mol |
| Exact Mass | 636.17 |
| IUPAC Name | 3-[3-[4-amino-2-[6-chloro-1-(3,3,4,4,4-pentafluorobutyl)indazol-3-yl]-5-methyl-6-oxo-7H-pyrrolo[2,3-d]pyrimidin-5-yl]phenyl]-2,2-dimethylpropanoic acid |
| SMILES | CC(C)(Cc1cccc(C2(C)C(=O)Nc3nc(-c4nn(CCC(F)(F)C(F)(F)F)c5cc(Cl)ccc45)nc(N)c32)c1)C(=O)O |
| InChI | InChI=1S/C29H26ClF5N6O3/c1-26(2,25(43)44)13-14-5-4-6-15(11-14)27(3)19-21(36)37-23(38-22(19)39-24(27)42)20-17-8-7-16(30)12-18(17)41(40-20)10-9-28(31,32)29(33,34)35/h4-8,11-12H,9-10,13H2,1-3H3,(H,43,44)(H3,36,37,38,39,42) |
| InChIKey | HJYLLBMLLLHWRK-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 136.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.01 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|