C29H23ClF3N7O3S — CID 129242669
3-[2-[(5S)-4-amino-2-[6-chloro-1-[(2,3,6-trifluorophenyl)methyl]indazol-3-yl]-5-methyl-6-oxo-7H-pyrrolo[2,3-d]pyrimidin-5-yl]-1,3-thiazol-4-yl]-2,2-dimethylpropanoic acid (PubChem CID 129242669) has the molecular formula C29H23ClF3N7O3S and a molecular weight of 642.06 g/mol. Its IUPAC name is 3-[2-[(5S)-4-amino-2-[6-chloro-1-[(2,3,6-trifluorophenyl)methyl]indazol-3-yl]-5-methyl-6-oxo-7H-pyrrolo[2,3-d]pyrimidin-5-yl]-1,3-thiazol-4-yl]-2,2-dimethylpropanoic acid.
| Compound Name | 3-[2-[(5S)-4-amino-2-[6-chloro-1-[(2,3,6-trifluorophenyl)methyl]indazol-3-yl]-5-methyl-6-oxo-7H-pyrrolo[2,3-d]pyrimidin-5-yl]-1,3-thiazol-4-yl]-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 129242669 |
| Molecular Formula | C29H23ClF3N7O3S |
| Molecular Weight | 642.06 g/mol |
| Exact Mass | 641.12 |
| IUPAC Name | 3-[2-[(5S)-4-amino-2-[6-chloro-1-[(2,3,6-trifluorophenyl)methyl]indazol-3-yl]-5-methyl-6-oxo-7H-pyrrolo[2,3-d]pyrimidin-5-yl]-1,3-thiazol-4-yl]-2,2-dimethylpropanoic acid |
| SMILES | CC(C)(Cc1csc([C@]2(C)C(=O)Nc3nc(-c4nn(Cc5c(F)ccc(F)c5F)c5cc(Cl)ccc45)nc(N)c32)n1)C(=O)O |
| InChI | InChI=1S/C29H23ClF3N7O3S/c1-28(2,27(42)43)9-13-11-44-26(35-13)29(3)19-22(34)36-24(37-23(19)38-25(29)41)21-14-5-4-12(30)8-18(14)40(39-21)10-15-16(31)6-7-17(32)20(15)33/h4-8,11H,9-10H2,1-3H3,(H,42,43)(H3,34,36,37,38,41)/t29-/m0/s1 |
| InChIKey | YIBOFMZPYHMORQ-LJAQVGFWSA-N |
| XLogP | 5.56 |
| TPSA | 148.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.06 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|