C26H21ClF5N7O3 — CID 129242700
3-[6-[4-amino-2-[6-chloro-1-(3,3,4,4,4-pentafluorobutyl)indazol-3-yl]-5-methyl-6-oxo-7H-pyrrolo[2,3-d]pyrimidin-5-yl]-3-pyridinyl]propanoic acid (PubChem CID 129242700) has the molecular formula C26H21ClF5N7O3 and a molecular weight of 609.94 g/mol. Its IUPAC name is 3-[6-[4-amino-2-[6-chloro-1-(3,3,4,4,4-pentafluorobutyl)indazol-3-yl]-5-methyl-6-oxo-7H-pyrrolo[2,3-d]pyrimidin-5-yl]-3-pyridinyl]propanoic acid.
| Compound Name | 3-[6-[4-amino-2-[6-chloro-1-(3,3,4,4,4-pentafluorobutyl)indazol-3-yl]-5-methyl-6-oxo-7H-pyrrolo[2,3-d]pyrimidin-5-yl]-3-pyridinyl]propanoic acid |
|---|---|
| PubChem CID | 129242700 |
| Molecular Formula | C26H21ClF5N7O3 |
| Molecular Weight | 609.94 g/mol |
| Exact Mass | 609.13 |
| IUPAC Name | 3-[6-[4-amino-2-[6-chloro-1-(3,3,4,4,4-pentafluorobutyl)indazol-3-yl]-5-methyl-6-oxo-7H-pyrrolo[2,3-d]pyrimidin-5-yl]-3-pyridinyl]propanoic acid |
| SMILES | CC1(c2ccc(CCC(=O)O)cn2)C(=O)Nc2nc(-c3nn(CCC(F)(F)C(F)(F)F)c4cc(Cl)ccc34)nc(N)c21 |
| InChI | InChI=1S/C26H21ClF5N7O3/c1-24(16-6-2-12(11-34-16)3-7-17(40)41)18-20(33)35-22(36-21(18)37-23(24)42)19-14-5-4-13(27)10-15(14)39(38-19)9-8-25(28,29)26(30,31)32/h2,4-6,10-11H,3,7-9H2,1H3,(H,40,41)(H3,33,35,36,37,42) |
| InChIKey | SCKTYCCMAMRBQL-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 148.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.94 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|