C27H20ClF5N6O3 — CID 129242719
(E)-3-[4-[4-amino-2-[6-chloro-1-(3,3,4,4,4-pentafluorobutyl)indazol-3-yl]-5-methyl-6-oxo-7H-pyrrolo[2,3-d]pyrimidin-5-yl]phenyl]prop-2-enoic acid (PubChem CID 129242719) has the molecular formula C27H20ClF5N6O3 and a molecular weight of 606.94 g/mol. Its IUPAC name is (E)-3-[4-[4-amino-2-[6-chloro-1-(3,3,4,4,4-pentafluorobutyl)indazol-3-yl]-5-methyl-6-oxo-7H-pyrrolo[2,3-d]pyrimidin-5-yl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[4-amino-2-[6-chloro-1-(3,3,4,4,4-pentafluorobutyl)indazol-3-yl]-5-methyl-6-oxo-7H-pyrrolo[2,3-d]pyrimidin-5-yl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 129242719 |
| Molecular Formula | C27H20ClF5N6O3 |
| Molecular Weight | 606.94 g/mol |
| Exact Mass | 606.12 |
| IUPAC Name | (E)-3-[4-[4-amino-2-[6-chloro-1-(3,3,4,4,4-pentafluorobutyl)indazol-3-yl]-5-methyl-6-oxo-7H-pyrrolo[2,3-d]pyrimidin-5-yl]phenyl]prop-2-enoic acid |
| SMILES | CC1(c2ccc(/C=C/C(=O)O)cc2)C(=O)Nc2nc(-c3nn(CCC(F)(F)C(F)(F)F)c4cc(Cl)ccc34)nc(N)c21 |
| InChI | InChI=1S/C27H20ClF5N6O3/c1-25(14-5-2-13(3-6-14)4-9-18(40)41)19-21(34)35-23(36-22(19)37-24(25)42)20-16-8-7-15(28)12-17(16)39(38-20)11-10-26(29,30)27(31,32)33/h2-9,12H,10-11H2,1H3,(H,40,41)(H3,34,35,36,37,42)/b9-4+ |
| InChIKey | QBKGYVJYWUQVCO-RUDMXATFSA-N |
| XLogP | 5.67 |
| TPSA | 136.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.94 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|