C29H24F3N7O3S — CID 129242848
3-[2-[(5S)-4-amino-5-methyl-6-oxo-2-[1-[(2,3,6-trifluorophenyl)methyl]indazol-3-yl]-7H-pyrrolo[2,3-d]pyrimidin-5-yl]-1,3-thiazol-4-yl]-2,2-dimethylpropanoic acid (PubChem CID 129242848) has the molecular formula C29H24F3N7O3S and a molecular weight of 607.62 g/mol. Its IUPAC name is 3-[2-[(5S)-4-amino-5-methyl-6-oxo-2-[1-[(2,3,6-trifluorophenyl)methyl]indazol-3-yl]-7H-pyrrolo[2,3-d]pyrimidin-5-yl]-1,3-thiazol-4-yl]-2,2-dimethylpropanoic acid.
| Compound Name | 3-[2-[(5S)-4-amino-5-methyl-6-oxo-2-[1-[(2,3,6-trifluorophenyl)methyl]indazol-3-yl]-7H-pyrrolo[2,3-d]pyrimidin-5-yl]-1,3-thiazol-4-yl]-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 129242848 |
| Molecular Formula | C29H24F3N7O3S |
| Molecular Weight | 607.62 g/mol |
| Exact Mass | 607.16 |
| IUPAC Name | 3-[2-[(5S)-4-amino-5-methyl-6-oxo-2-[1-[(2,3,6-trifluorophenyl)methyl]indazol-3-yl]-7H-pyrrolo[2,3-d]pyrimidin-5-yl]-1,3-thiazol-4-yl]-2,2-dimethylpropanoic acid |
| SMILES | CC(C)(Cc1csc([C@]2(C)C(=O)Nc3nc(-c4nn(Cc5c(F)ccc(F)c5F)c5ccccc45)nc(N)c32)n1)C(=O)O |
| InChI | InChI=1S/C29H24F3N7O3S/c1-28(2,27(41)42)10-13-12-43-26(34-13)29(3)19-22(33)35-24(36-23(19)37-25(29)40)21-14-6-4-5-7-18(14)39(38-21)11-15-16(30)8-9-17(31)20(15)32/h4-9,12H,10-11H2,1-3H3,(H,41,42)(H3,33,35,36,37,40)/t29-/m0/s1 |
| InChIKey | RJALJCBCOSQYQD-LJAQVGFWSA-N |
| XLogP | 4.91 |
| TPSA | 148.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.62 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|