C24H18F5N11O — CID 129242904
4-amino-5-methyl-2-[1-(3,3,4,4,4-pentafluorobutyl)pyrazolo[5,4-b]pyridin-3-yl]-5-[3-(2H-tetrazol-5-yl)phenyl]-7H-pyrrolo[2,3-d]pyrimidin-6-one (PubChem CID 129242904) has the molecular formula C24H18F5N11O and a molecular weight of 571.47 g/mol. Its IUPAC name is 4-amino-5-methyl-2-[1-(3,3,4,4,4-pentafluorobutyl)pyrazolo[5,4-b]pyridin-3-yl]-5-[3-(2H-tetrazol-5-yl)phenyl]-7H-pyrrolo[2,3-d]pyrimidin-6-one.
| Compound Name | 4-amino-5-methyl-2-[1-(3,3,4,4,4-pentafluorobutyl)pyrazolo[5,4-b]pyridin-3-yl]-5-[3-(2H-tetrazol-5-yl)phenyl]-7H-pyrrolo[2,3-d]pyrimidin-6-one |
|---|---|
| PubChem CID | 129242904 |
| Molecular Formula | C24H18F5N11O |
| Molecular Weight | 571.47 g/mol |
| Exact Mass | 571.16 |
| IUPAC Name | 4-amino-5-methyl-2-[1-(3,3,4,4,4-pentafluorobutyl)pyrazolo[5,4-b]pyridin-3-yl]-5-[3-(2H-tetrazol-5-yl)phenyl]-7H-pyrrolo[2,3-d]pyrimidin-6-one |
| SMILES | CC1(c2cccc(-c3nn[nH]n3)c2)C(=O)Nc2nc(-c3nn(CCC(F)(F)C(F)(F)F)c4ncccc34)nc(N)c21 |
| InChI | InChI=1S/C24H18F5N11O/c1-22(12-5-2-4-11(10-12)17-35-38-39-36-17)14-16(30)32-19(33-18(14)34-21(22)41)15-13-6-3-8-31-20(13)40(37-15)9-7-23(25,26)24(27,28)29/h2-6,8,10H,7,9H2,1H3,(H,35,36,38,39)(H3,30,32,33,34,41) |
| InChIKey | RLBLXDMSCGLQQN-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 166.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.47 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|