C28H26F5N7O3 — CID 129242960
3-[3-[4-amino-5-methyl-6-oxo-2-[1-(3,3,4,4,4-pentafluorobutyl)pyrazolo[5,4-b]pyridin-3-yl]-7H-pyrrolo[2,3-d]pyrimidin-5-yl]phenyl]-2,2-dimethylpropanoic acid (PubChem CID 129242960) has the molecular formula C28H26F5N7O3 and a molecular weight of 603.55 g/mol. Its IUPAC name is 3-[3-[4-amino-5-methyl-6-oxo-2-[1-(3,3,4,4,4-pentafluorobutyl)pyrazolo[5,4-b]pyridin-3-yl]-7H-pyrrolo[2,3-d]pyrimidin-5-yl]phenyl]-2,2-dimethylpropanoic acid.
| Compound Name | 3-[3-[4-amino-5-methyl-6-oxo-2-[1-(3,3,4,4,4-pentafluorobutyl)pyrazolo[5,4-b]pyridin-3-yl]-7H-pyrrolo[2,3-d]pyrimidin-5-yl]phenyl]-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 129242960 |
| Molecular Formula | C28H26F5N7O3 |
| Molecular Weight | 603.55 g/mol |
| Exact Mass | 603.20 |
| IUPAC Name | 3-[3-[4-amino-5-methyl-6-oxo-2-[1-(3,3,4,4,4-pentafluorobutyl)pyrazolo[5,4-b]pyridin-3-yl]-7H-pyrrolo[2,3-d]pyrimidin-5-yl]phenyl]-2,2-dimethylpropanoic acid |
| SMILES | CC(C)(Cc1cccc(C2(C)C(=O)Nc3nc(-c4nn(CCC(F)(F)C(F)(F)F)c5ncccc45)nc(N)c32)c1)C(=O)O |
| InChI | InChI=1S/C28H26F5N7O3/c1-25(2,24(42)43)13-14-6-4-7-15(12-14)26(3)17-19(34)36-21(37-20(17)38-23(26)41)18-16-8-5-10-35-22(16)40(39-18)11-9-27(29,30)28(31,32)33/h4-8,10,12H,9,11,13H2,1-3H3,(H,42,43)(H3,34,36,37,38,41) |
| InChIKey | WSGLLEMAAIPASH-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 148.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.55 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|