C24H23F5N10O3 — CID 129243158
ethyl 3-[4-[4-amino-5-methyl-6-oxo-2-[1-(3,3,4,4,4-pentafluorobutyl)pyrazolo[5,4-b]pyridin-3-yl]-7H-pyrrolo[2,3-d]pyrimidin-5-yl]triazol-2-yl]propanoate (PubChem CID 129243158) has the molecular formula C24H23F5N10O3 and a molecular weight of 594.51 g/mol. Its IUPAC name is ethyl 3-[4-[4-amino-5-methyl-6-oxo-2-[1-(3,3,4,4,4-pentafluorobutyl)pyrazolo[5,4-b]pyridin-3-yl]-7H-pyrrolo[2,3-d]pyrimidin-5-yl]triazol-2-yl]propanoate.
| Compound Name | ethyl 3-[4-[4-amino-5-methyl-6-oxo-2-[1-(3,3,4,4,4-pentafluorobutyl)pyrazolo[5,4-b]pyridin-3-yl]-7H-pyrrolo[2,3-d]pyrimidin-5-yl]triazol-2-yl]propanoate |
|---|---|
| PubChem CID | 129243158 |
| Molecular Formula | C24H23F5N10O3 |
| Molecular Weight | 594.51 g/mol |
| Exact Mass | 594.19 |
| IUPAC Name | ethyl 3-[4-[4-amino-5-methyl-6-oxo-2-[1-(3,3,4,4,4-pentafluorobutyl)pyrazolo[5,4-b]pyridin-3-yl]-7H-pyrrolo[2,3-d]pyrimidin-5-yl]triazol-2-yl]propanoate |
| SMILES | CCOC(=O)CCn1ncc(C2(C)C(=O)Nc3nc(-c4nn(CCC(F)(F)C(F)(F)F)c5ncccc45)nc(N)c32)n1 |
| InChI | InChI=1S/C24H23F5N10O3/c1-3-42-14(40)6-9-39-32-11-13(36-39)22(2)15-17(30)33-19(34-18(15)35-21(22)41)16-12-5-4-8-31-20(12)38(37-16)10-7-23(25,26)24(27,28)29/h4-5,8,11H,3,6-7,9-10H2,1-2H3,(H3,30,33,34,35,41) |
| InChIKey | WRYNJYDHOCESPA-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 168.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.51 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|