trans-(1R,2R)-2-hydroxycyclopentane-1-carboxylic acid

C6H10O3 — CID 12924462

IUPACtrans-(1R,2R)-2-hydroxycyclopentane-1-carboxylic acid
SMILESO=C(O)[C@@H]1CCC[C@H]1O
InChIInChI=1S/C6H10O3/c7-5-3-1-2-4(5)6(8)9/h4-5,7H,1-3H2,(H,8,9)/t4-,5-/m1/s1
InChIKeyVCHGSWURBGPKQZ-RFZPGFLSSA-N
MW130.14 g/mol
LogP0.23
Rot. Bonds1

About trans-(1R,2R)-2-hydroxycyclopentane-1-carboxylic acid

trans-(1R,2R)-2-hydroxycyclopentane-1-carboxylic acid (PubChem CID 12924462) has the molecular formula C6H10O3 and a molecular weight of 130.14 g/mol. Its IUPAC name is trans-(1R,2R)-2-hydroxycyclopentane-1-carboxylic acid.

Molecular Properties

Compound Nametrans-(1R,2R)-2-hydroxycyclopentane-1-carboxylic acid
PubChem CID12924462
Molecular FormulaC6H10O3
Molecular Weight130.14 g/mol
Exact Mass130.06
IUPAC Nametrans-(1R,2R)-2-hydroxycyclopentane-1-carboxylic acid
SMILESO=C(O)[C@@H]1CCC[C@H]1O
InChIInChI=1S/C6H10O3/c7-5-3-1-2-4(5)6(8)9/h4-5,7H,1-3H2,(H,8,9)/t4-,5-/m1/s1
InChIKeyVCHGSWURBGPKQZ-RFZPGFLSSA-N
XLogP0.23
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms9
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500130.14
LogP ≤ 50.23
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze trans-(1R,2R)-2-hydroxycyclopentane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of trans-(1R,2R)-2-hydroxycyclopentane-1-carboxylic acid?
The IUPAC name of trans-(1R,2R)-2-hydroxycyclopentane-1-carboxylic acid (CID 12924462) is trans-(1R,2R)-2-hydroxycyclopentane-1-carboxylic acid.
What is the SMILES notation for trans-(1R,2R)-2-hydroxycyclopentane-1-carboxylic acid?
The canonical SMILES for trans-(1R,2R)-2-hydroxycyclopentane-1-carboxylic acid is O=C(O)[C@@H]1CCC[C@H]1O.
What is the InChIKey of trans-(1R,2R)-2-hydroxycyclopentane-1-carboxylic acid?
The InChIKey is VCHGSWURBGPKQZ-RFZPGFLSSA-N. The full InChI is InChI=1S/C6H10O3/c7-5-3-1-2-4(5)6(8)9/h4-5,7H,1-3H2,(H,8,9)/t4-,5-/m1/s1.
What are the key properties of trans-(1R,2R)-2-hydroxycyclopentane-1-carboxylic acid?
trans-(1R,2R)-2-hydroxycyclopentane-1-carboxylic acid has a molecular weight of 130.14 g/mol, XLogP of 0.23, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1R,2R)-2-hydroxycyclopentane-1-carboxylic acid is sourced from PubChem (CID 12924462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).