C26H26N4O3 — CID 129244849
2-[[8-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylanilino]-1,7-naphthyridin-4-yl]methylamino]ethanol (PubChem CID 129244849) has the molecular formula C26H26N4O3 and a molecular weight of 442.52 g/mol. Its IUPAC name is 2-[[8-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylanilino]-1,7-naphthyridin-4-yl]methylamino]ethanol.
| Compound Name | 2-[[8-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylanilino]-1,7-naphthyridin-4-yl]methylamino]ethanol |
|---|---|
| PubChem CID | 129244849 |
| Molecular Formula | C26H26N4O3 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | 2-[[8-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylanilino]-1,7-naphthyridin-4-yl]methylamino]ethanol |
| SMILES | Cc1c(Nc2nccc3c(CNCCO)ccnc23)cccc1-c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C26H26N4O3/c1-17-20(18-5-6-23-24(15-18)33-14-13-32-23)3-2-4-22(17)30-26-25-21(8-10-29-26)19(7-9-28-25)16-27-11-12-31/h2-10,15,27,31H,11-14,16H2,1H3,(H,29,30) |
| InChIKey | SIUYRQLICWALDJ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 88.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|