C21H23NO5 — CID 129245002
[2-(1,1-dimethoxyethyl)benzo[f][1]benzofuran-3-yl]-morpholin-4-ylmethanone (PubChem CID 129245002) has the molecular formula C21H23NO5 and a molecular weight of 369.42 g/mol. Its IUPAC name is [2-(1,1-dimethoxyethyl)benzo[f][1]benzofuran-3-yl]-morpholin-4-ylmethanone.
| Compound Name | [2-(1,1-dimethoxyethyl)benzo[f][1]benzofuran-3-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 129245002 |
| Molecular Formula | C21H23NO5 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | [2-(1,1-dimethoxyethyl)benzo[f][1]benzofuran-3-yl]-morpholin-4-ylmethanone |
| SMILES | COC(C)(OC)c1oc2cc3ccccc3cc2c1C(=O)N1CCOCC1 |
| InChI | InChI=1S/C21H23NO5/c1-21(24-2,25-3)19-18(20(23)22-8-10-26-11-9-22)16-12-14-6-4-5-7-15(14)13-17(16)27-19/h4-7,12-13H,8-11H2,1-3H3 |
| InChIKey | XQSAFWHGJGSTJY-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 61.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|