C17H25F3N2O2 — CID 129246127
N-ethyl-N'-[5-methoxy-2-methyl-4-(1,1,1-trifluoro-2-hydroxy-3-methylbutan-2-yl)phenyl]-N-methylmethanimidamide (PubChem CID 129246127) has the molecular formula C17H25F3N2O2 and a molecular weight of 346.39 g/mol. Its IUPAC name is N-ethyl-N'-[5-methoxy-2-methyl-4-(1,1,1-trifluoro-2-hydroxy-3-methylbutan-2-yl)phenyl]-N-methylmethanimidamide.
| Compound Name | N-ethyl-N'-[5-methoxy-2-methyl-4-(1,1,1-trifluoro-2-hydroxy-3-methylbutan-2-yl)phenyl]-N-methylmethanimidamide |
|---|---|
| PubChem CID | 129246127 |
| Molecular Formula | C17H25F3N2O2 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | N-ethyl-N'-[5-methoxy-2-methyl-4-(1,1,1-trifluoro-2-hydroxy-3-methylbutan-2-yl)phenyl]-N-methylmethanimidamide |
| SMILES | CCN(C)/C=N/c1cc(OC)c(C(O)(C(C)C)C(F)(F)F)cc1C |
| InChI | InChI=1S/C17H25F3N2O2/c1-7-22(5)10-21-14-9-15(24-6)13(8-12(14)4)16(23,11(2)3)17(18,19)20/h8-11,23H,7H2,1-6H3/b21-10+ |
| InChIKey | UFYXCPLLSJSLSW-UFFVCSGVSA-N |
| XLogP | 4.02 |
| TPSA | 45.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|