About 4-[4-[[(1S)-7-bromo-2,3-dihydro-1H-inden-1-yl]oxy]-2-ethylphenyl]piperidine
4-[4-[[(1S)-7-bromo-2,3-dihydro-1H-inden-1-yl]oxy]-2-ethylphenyl]piperidine (PubChem CID 129246771) has the molecular formula C22H26BrNO
and a molecular weight of 400.36 g/mol. Its IUPAC name is 4-[4-[[(1S)-7-bromo-2,3-dihydro-1H-inden-1-yl]oxy]-2-ethylphenyl]piperidine.
Molecular Properties
| Compound Name | 4-[4-[[(1S)-7-bromo-2,3-dihydro-1H-inden-1-yl]oxy]-2-ethylphenyl]piperidine |
| PubChem CID | 129246771 |
| Molecular Formula | C22H26BrNO |
| Molecular Weight | 400.36 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | 4-[4-[[(1S)-7-bromo-2,3-dihydro-1H-inden-1-yl]oxy]-2-ethylphenyl]piperidine |
| SMILES | CCc1cc(O[C@H]2CCc3cccc(Br)c32)ccc1C1CCNCC1 |
| InChI | InChI=1S/C22H26BrNO/c1-2-15-14-18(7-8-19(15)16-10-12-24-13-11-16)25-21-9-6-17-4-3-5-20(23)22(17)21/h3-5,7-8,14,16,21,24H,2,6,9-13H2,1H3/t21-/m0/s1 |
| InChIKey | NLAASTGMDNNLCB-NRFANRHFSA-N |
| XLogP | 5.54 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 400.36 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[4-[[(1S)-7-bromo-2,3-dihydro-1H-inden-1-yl]oxy]-2-ethylphenyl]piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-[[(1S)-7-bromo-2,3-dihydro-1H-inden-1-yl]oxy]-2-ethylphenyl]piperidine?
The IUPAC name of 4-[4-[[(1S)-7-bromo-2,3-dihydro-1H-inden-1-yl]oxy]-2-ethylphenyl]piperidine (CID 129246771) is 4-[4-[[(1S)-7-bromo-2,3-dihydro-1H-inden-1-yl]oxy]-2-ethylphenyl]piperidine.
What is the SMILES notation for 4-[4-[[(1S)-7-bromo-2,3-dihydro-1H-inden-1-yl]oxy]-2-ethylphenyl]piperidine?
The canonical SMILES for 4-[4-[[(1S)-7-bromo-2,3-dihydro-1H-inden-1-yl]oxy]-2-ethylphenyl]piperidine is CCc1cc(O[C@H]2CCc3cccc(Br)c32)ccc1C1CCNCC1.
What is the InChIKey of 4-[4-[[(1S)-7-bromo-2,3-dihydro-1H-inden-1-yl]oxy]-2-ethylphenyl]piperidine?
The InChIKey is NLAASTGMDNNLCB-NRFANRHFSA-N. The full InChI is InChI=1S/C22H26BrNO/c1-2-15-14-18(7-8-19(15)16-10-12-24-13-11-16)25-21-9-6-17-4-3-5-20(23)22(17)21/h3-5,7-8,14,16,21,24H,2,6,9-13H2,1H3/t21-/m0/s1.
What are the key properties of 4-[4-[[(1S)-7-bromo-2,3-dihydro-1H-inden-1-yl]oxy]-2-ethylphenyl]piperidine?
4-[4-[[(1S)-7-bromo-2,3-dihydro-1H-inden-1-yl]oxy]-2-ethylphenyl]piperidine has a molecular weight of 400.36 g/mol, XLogP of 5.54, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-[[(1S)-7-bromo-2,3-dihydro-1H-inden-1-yl]oxy]-2-ethylphenyl]piperidine is sourced from PubChem (CID 129246771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).