C14H16N2O3 — CID 129246804
1-[(2R)-oxolane-2-carbonyl]-2,3-dihydroisoindole-1-carboxamide (PubChem CID 129246804) has the molecular formula C14H16N2O3 and a molecular weight of 260.29 g/mol. Its IUPAC name is 1-[(2R)-oxolane-2-carbonyl]-2,3-dihydroisoindole-1-carboxamide.
| Compound Name | 1-[(2R)-oxolane-2-carbonyl]-2,3-dihydroisoindole-1-carboxamide |
|---|---|
| PubChem CID | 129246804 |
| Molecular Formula | C14H16N2O3 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 1-[(2R)-oxolane-2-carbonyl]-2,3-dihydroisoindole-1-carboxamide |
| SMILES | NC(=O)C1(C(=O)[C@H]2CCCO2)NCc2ccccc21 |
| InChI | InChI=1S/C14H16N2O3/c15-13(18)14(12(17)11-6-3-7-19-11)10-5-2-1-4-9(10)8-16-14/h1-2,4-5,11,16H,3,6-8H2,(H2,15,18)/t11-,14?/m1/s1 |
| InChIKey | TXQXLSHILNZFTI-YNODCEANSA-N |
| XLogP | 0.22 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|