C13H18N2O3 — CID 129246923
2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-3,5-dimethoxyaniline (PubChem CID 129246923) has the molecular formula C13H18N2O3 and a molecular weight of 250.30 g/mol. Its IUPAC name is 2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-3,5-dimethoxyaniline.
| Compound Name | 2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-3,5-dimethoxyaniline |
|---|---|
| PubChem CID | 129246923 |
| Molecular Formula | C13H18N2O3 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | 2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-3,5-dimethoxyaniline |
| SMILES | COc1cc(N)c(C2=NC(C)(C)CO2)c(OC)c1 |
| InChI | InChI=1S/C13H18N2O3/c1-13(2)7-18-12(15-13)11-9(14)5-8(16-3)6-10(11)17-4/h5-6H,7,14H2,1-4H3 |
| InChIKey | QFCIFSMRPYFEGM-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 66.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|