C16H17N5O — CID 129247113
N-[[(3R)-1-cyanopyrrolidin-3-yl]methyl]-1-phenylpyrazole-3-carboxamide (PubChem CID 129247113) has the molecular formula C16H17N5O and a molecular weight of 295.35 g/mol. Its IUPAC name is N-[[(3R)-1-cyanopyrrolidin-3-yl]methyl]-1-phenylpyrazole-3-carboxamide.
| Compound Name | N-[[(3R)-1-cyanopyrrolidin-3-yl]methyl]-1-phenylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 129247113 |
| Molecular Formula | C16H17N5O |
| Molecular Weight | 295.35 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | N-[[(3R)-1-cyanopyrrolidin-3-yl]methyl]-1-phenylpyrazole-3-carboxamide |
| SMILES | N#CN1CC[C@H](CNC(=O)c2ccn(-c3ccccc3)n2)C1 |
| InChI | InChI=1S/C16H17N5O/c17-12-20-8-6-13(11-20)10-18-16(22)15-7-9-21(19-15)14-4-2-1-3-5-14/h1-5,7,9,13H,6,8,10-11H2,(H,18,22)/t13-/m1/s1 |
| InChIKey | XTUZBRUXFUDTMK-CYBMUJFWSA-N |
| XLogP | 1.41 |
| TPSA | 73.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.35 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|