C14H22N2O2Si2 — CID 12924729
1,4-bis(trimethylsilyloxy)cyclohexa-2,5-diene-1,4-dicarbonitrile (PubChem CID 12924729) has the molecular formula C14H22N2O2Si2 and a molecular weight of 306.51 g/mol. Its IUPAC name is 1,4-bis(trimethylsilyloxy)cyclohexa-2,5-diene-1,4-dicarbonitrile.
| Compound Name | 1,4-bis(trimethylsilyloxy)cyclohexa-2,5-diene-1,4-dicarbonitrile |
|---|---|
| PubChem CID | 12924729 |
| Molecular Formula | C14H22N2O2Si2 |
| Molecular Weight | 306.51 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 1,4-bis(trimethylsilyloxy)cyclohexa-2,5-diene-1,4-dicarbonitrile |
| SMILES | C[Si](C)(C)OC1(C#N)C=CC(C#N)(O[Si](C)(C)C)C=C1 |
| InChI | InChI=1S/C14H22N2O2Si2/c1-19(2,3)17-13(11-15)7-9-14(12-16,10-8-13)18-20(4,5)6/h7-10H,1-6H3 |
| InChIKey | IKPWJTVZYGOVLY-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 66.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.51 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|