C13H11ClF2O5 — CID 129247351
2-[acetyloxy-[3-chloro-4-(difluoromethoxy)phenyl]methyl]prop-2-enoic acid (PubChem CID 129247351) has the molecular formula C13H11ClF2O5 and a molecular weight of 320.68 g/mol. Its IUPAC name is 2-[acetyloxy-[3-chloro-4-(difluoromethoxy)phenyl]methyl]prop-2-enoic acid.
| Compound Name | 2-[acetyloxy-[3-chloro-4-(difluoromethoxy)phenyl]methyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 129247351 |
| Molecular Formula | C13H11ClF2O5 |
| Molecular Weight | 320.68 g/mol |
| Exact Mass | 320.03 |
| IUPAC Name | 2-[acetyloxy-[3-chloro-4-(difluoromethoxy)phenyl]methyl]prop-2-enoic acid |
| SMILES | C=C(C(=O)O)C(OC(C)=O)c1ccc(OC(F)F)c(Cl)c1 |
| InChI | InChI=1S/C13H11ClF2O5/c1-6(12(18)19)11(20-7(2)17)8-3-4-10(9(14)5-8)21-13(15)16/h3-5,11,13H,1H2,2H3,(H,18,19) |
| InChIKey | CIWVHXNIDVRQEP-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.68 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|