C18H19F2N7O2 — CID 129247462
7-(difluoromethoxy)-N-[1-(1-methyltetrazol-5-yl)piperidin-4-yl]quinoline-3-carboxamide (PubChem CID 129247462) has the molecular formula C18H19F2N7O2 and a molecular weight of 403.39 g/mol. Its IUPAC name is 7-(difluoromethoxy)-N-[1-(1-methyltetrazol-5-yl)piperidin-4-yl]quinoline-3-carboxamide.
| Compound Name | 7-(difluoromethoxy)-N-[1-(1-methyltetrazol-5-yl)piperidin-4-yl]quinoline-3-carboxamide |
|---|---|
| PubChem CID | 129247462 |
| Molecular Formula | C18H19F2N7O2 |
| Molecular Weight | 403.39 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | 7-(difluoromethoxy)-N-[1-(1-methyltetrazol-5-yl)piperidin-4-yl]quinoline-3-carboxamide |
| SMILES | Cn1nnnc1N1CCC(NC(=O)c2cnc3cc(OC(F)F)ccc3c2)CC1 |
| InChI | InChI=1S/C18H19F2N7O2/c1-26-18(23-24-25-26)27-6-4-13(5-7-27)22-16(28)12-8-11-2-3-14(29-17(19)20)9-15(11)21-10-12/h2-3,8-10,13,17H,4-7H2,1H3,(H,22,28) |
| InChIKey | MULBRCOFANWGJX-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 98.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.39 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |