About 1-(4-aminocyclohexyl)-2,2,2-trifluoroethanol;hydrochloride
1-(4-aminocyclohexyl)-2,2,2-trifluoroethanol;hydrochloride (PubChem CID 129247507) has the molecular formula C8H15ClF3NO
and a molecular weight of 233.66 g/mol. Its IUPAC name is 1-(4-aminocyclohexyl)-2,2,2-trifluoroethanol;hydrochloride.
Molecular Properties
| Compound Name | 1-(4-aminocyclohexyl)-2,2,2-trifluoroethanol;hydrochloride |
| PubChem CID | 129247507 |
| Molecular Formula | C8H15ClF3NO |
| Molecular Weight | 233.66 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | 1-(4-aminocyclohexyl)-2,2,2-trifluoroethanol;hydrochloride |
| SMILES | Cl.NC1CCC(C(O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C8H14F3NO.ClH/c9-8(10,11)7(13)5-1-3-6(12)4-2-5;/h5-7,13H,1-4,12H2;1H |
| InChIKey | MZEJEGWCUWUVNV-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.66 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(4-aminocyclohexyl)-2,2,2-trifluoroethanol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-aminocyclohexyl)-2,2,2-trifluoroethanol;hydrochloride?
The IUPAC name of 1-(4-aminocyclohexyl)-2,2,2-trifluoroethanol;hydrochloride (CID 129247507) is 1-(4-aminocyclohexyl)-2,2,2-trifluoroethanol;hydrochloride.
What is the SMILES notation for 1-(4-aminocyclohexyl)-2,2,2-trifluoroethanol;hydrochloride?
The canonical SMILES for 1-(4-aminocyclohexyl)-2,2,2-trifluoroethanol;hydrochloride is Cl.NC1CCC(C(O)C(F)(F)F)CC1.
What is the InChIKey of 1-(4-aminocyclohexyl)-2,2,2-trifluoroethanol;hydrochloride?
The InChIKey is MZEJEGWCUWUVNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14F3NO.ClH/c9-8(10,11)7(13)5-1-3-6(12)4-2-5;/h5-7,13H,1-4,12H2;1H.
What are the key properties of 1-(4-aminocyclohexyl)-2,2,2-trifluoroethanol;hydrochloride?
1-(4-aminocyclohexyl)-2,2,2-trifluoroethanol;hydrochloride has a molecular weight of 233.66 g/mol, XLogP of 1.85, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-aminocyclohexyl)-2,2,2-trifluoroethanol;hydrochloride is sourced from PubChem (CID 129247507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).