C9H14F3NO3 — CID 129247542
[4-(2,2,2-trifluoro-1-hydroxyethyl)cyclohexyl]carbamic acid (PubChem CID 129247542) has the molecular formula C9H14F3NO3 and a molecular weight of 241.21 g/mol. Its IUPAC name is [4-(2,2,2-trifluoro-1-hydroxyethyl)cyclohexyl]carbamic acid.
| Compound Name | [4-(2,2,2-trifluoro-1-hydroxyethyl)cyclohexyl]carbamic acid |
|---|---|
| PubChem CID | 129247542 |
| Molecular Formula | C9H14F3NO3 |
| Molecular Weight | 241.21 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | [4-(2,2,2-trifluoro-1-hydroxyethyl)cyclohexyl]carbamic acid |
| SMILES | O=C(O)NC1CCC(C(O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C9H14F3NO3/c10-9(11,12)7(14)5-1-3-6(4-2-5)13-8(15)16/h5-7,13-14H,1-4H2,(H,15,16) |
| InChIKey | YGYQBSIZUQBUEV-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.21 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |