About (2S)-2-[(4-aminocyclohexyl)amino]-3,3,3-trifluoropropan-1-ol
(2S)-2-[(4-aminocyclohexyl)amino]-3,3,3-trifluoropropan-1-ol (PubChem CID 129247945) has the molecular formula C9H17F3N2O
and a molecular weight of 226.24 g/mol. Its IUPAC name is (2S)-2-[(4-aminocyclohexyl)amino]-3,3,3-trifluoropropan-1-ol.
Molecular Properties
| Compound Name | (2S)-2-[(4-aminocyclohexyl)amino]-3,3,3-trifluoropropan-1-ol |
| PubChem CID | 129247945 |
| Molecular Formula | C9H17F3N2O |
| Molecular Weight | 226.24 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | (2S)-2-[(4-aminocyclohexyl)amino]-3,3,3-trifluoropropan-1-ol |
| SMILES | NC1CCC(N[C@@H](CO)C(F)(F)F)CC1 |
| InChI | InChI=1S/C9H17F3N2O/c10-9(11,12)8(5-15)14-7-3-1-6(13)2-4-7/h6-8,14-15H,1-5,13H2/t6?,7?,8-/m0/s1 |
| InChIKey | INOCYAMIKBRWQK-RRQHEKLDSA-N |
| XLogP | 0.77 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.24 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S)-2-[(4-aminocyclohexyl)amino]-3,3,3-trifluoropropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[(4-aminocyclohexyl)amino]-3,3,3-trifluoropropan-1-ol?
The IUPAC name of (2S)-2-[(4-aminocyclohexyl)amino]-3,3,3-trifluoropropan-1-ol (CID 129247945) is (2S)-2-[(4-aminocyclohexyl)amino]-3,3,3-trifluoropropan-1-ol.
What is the SMILES notation for (2S)-2-[(4-aminocyclohexyl)amino]-3,3,3-trifluoropropan-1-ol?
The canonical SMILES for (2S)-2-[(4-aminocyclohexyl)amino]-3,3,3-trifluoropropan-1-ol is NC1CCC(N[C@@H](CO)C(F)(F)F)CC1.
What is the InChIKey of (2S)-2-[(4-aminocyclohexyl)amino]-3,3,3-trifluoropropan-1-ol?
The InChIKey is INOCYAMIKBRWQK-RRQHEKLDSA-N. The full InChI is InChI=1S/C9H17F3N2O/c10-9(11,12)8(5-15)14-7-3-1-6(13)2-4-7/h6-8,14-15H,1-5,13H2/t6?,7?,8-/m0/s1.
What are the key properties of (2S)-2-[(4-aminocyclohexyl)amino]-3,3,3-trifluoropropan-1-ol?
(2S)-2-[(4-aminocyclohexyl)amino]-3,3,3-trifluoropropan-1-ol has a molecular weight of 226.24 g/mol, XLogP of 0.77, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[(4-aminocyclohexyl)amino]-3,3,3-trifluoropropan-1-ol is sourced from PubChem (CID 129247945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).