About (1-cyclohexyl-2,2,2-trifluoroethyl)hydrazine;hydrochloride
(1-cyclohexyl-2,2,2-trifluoroethyl)hydrazine;hydrochloride (PubChem CID 129247996) has the molecular formula C8H16ClF3N2
and a molecular weight of 232.68 g/mol. Its IUPAC name is (1-cyclohexyl-2,2,2-trifluoroethyl)hydrazine;hydrochloride.
Molecular Properties
| Compound Name | (1-cyclohexyl-2,2,2-trifluoroethyl)hydrazine;hydrochloride |
| PubChem CID | 129247996 |
| Molecular Formula | C8H16ClF3N2 |
| Molecular Weight | 232.68 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | (1-cyclohexyl-2,2,2-trifluoroethyl)hydrazine;hydrochloride |
| SMILES | Cl.NNC(C1CCCCC1)C(F)(F)F |
| InChI | InChI=1S/C8H15F3N2.ClH/c9-8(10,11)7(13-12)6-4-2-1-3-5-6;/h6-7,13H,1-5,12H2;1H |
| InChIKey | CEHBGVJYMFFRII-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.68 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (1-cyclohexyl-2,2,2-trifluoroethyl)hydrazine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-cyclohexyl-2,2,2-trifluoroethyl)hydrazine;hydrochloride?
The IUPAC name of (1-cyclohexyl-2,2,2-trifluoroethyl)hydrazine;hydrochloride (CID 129247996) is (1-cyclohexyl-2,2,2-trifluoroethyl)hydrazine;hydrochloride.
What is the SMILES notation for (1-cyclohexyl-2,2,2-trifluoroethyl)hydrazine;hydrochloride?
The canonical SMILES for (1-cyclohexyl-2,2,2-trifluoroethyl)hydrazine;hydrochloride is Cl.NNC(C1CCCCC1)C(F)(F)F.
What is the InChIKey of (1-cyclohexyl-2,2,2-trifluoroethyl)hydrazine;hydrochloride?
The InChIKey is CEHBGVJYMFFRII-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15F3N2.ClH/c9-8(10,11)7(13-12)6-4-2-1-3-5-6;/h6-7,13H,1-5,12H2;1H.
What are the key properties of (1-cyclohexyl-2,2,2-trifluoroethyl)hydrazine;hydrochloride?
(1-cyclohexyl-2,2,2-trifluoroethyl)hydrazine;hydrochloride has a molecular weight of 232.68 g/mol, XLogP of 2.38, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1-cyclohexyl-2,2,2-trifluoroethyl)hydrazine;hydrochloride is sourced from PubChem (CID 129247996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).